loading...| Preferred Name |
progesterone |
|
| Synonyms |
|
|
| Definitions |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17026 |
|
| charge |
0 |
|
| definition |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
| formula |
C21H30O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_59826 http://purl.obolibrary.org/obo/CHEBI_70709 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_parent_hydride | ||
| inchi |
InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 |
|
| inchikey |
RJKFOVLPORLFTN-LEKSSAKUSA-N |
|
| label |
progesterone |
|
| mass |
314.46170 |
|
| monoisotopicmass |
314.22458 |
|
| prefixIRI |
CHEBI:17026 |
|
| prefLabel |
progesterone |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 |