loading...| Preferred Name |
streptozocin |
|
| Synonyms |
streptozocin 2-deoxy-2-{[methyl(nitroso)carbamoyl]amino}-alpha-D-glucopyranose estreptozocina Zanosar streptozocine Streptozocinium 2-Deoxy-2-(((methylnitrosoamino)carbonyl)amino)-D-glucopyranose N-D-Glucosyl-(2)-N'-nitrosomethylurea streptozocinum 2-Deoxy-2-(3-methyl-3-nitrosoureido)-D-glucopyranose Streptozotocin N-D-Glucosyl-(2)-N'-nitrosomethylharnstoff |
|
| Definitions |
An N-nitrosourea that is an antibiotic produced by Streptomyces achromogenes. It is used as an antineoplastic agent and to induce diabetes in experimental animals. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9288 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23600389 Wikipedia:Streptozocin Patent:FR1434920 PMID:23662406 PMID:23151907 KEGG:C07313 CAS:18883-66-4 PMID:2954873 PMID:23333576 Patent:US2005271747 Patent:US2005272738 Beilstein:2060675 Patent:US4156777 PMID:12613763 Patent:US2008085882 KEGG:D05932 HMDB:HMDB0014572 Reaxys:2060675 DrugBank:DB00428 PMID:23612842 |
|
| definition |
An N-nitrosourea that is an antibiotic produced by Streptomyces achromogenes. It is used as an antineoplastic agent and to induce diabetes in experimental animals. |
|
| formula |
C8H15N3O7 |
|
| has exact synonym |
streptozocin 2-deoxy-2-{[methyl(nitroso)carbamoyl]amino}-alpha-D-glucopyranose |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_59517 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
streptozocin estreptozocina Zanosar streptozocine Streptozocinium 2-Deoxy-2-(((methylnitrosoamino)carbonyl)amino)-D-glucopyranose N-D-Glucosyl-(2)-N'-nitrosomethylurea streptozocinum 2-Deoxy-2-(3-methyl-3-nitrosoureido)-D-glucopyranose Streptozotocin N-D-Glucosyl-(2)-N'-nitrosomethylharnstoff |
|
| id |
CHEBI:9288 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H15N3O7/c1-11(10-17)8(16)9-4-6(14)5(13)3(2-12)18-7(4)15/h3-7,12-15H,2H2,1H3,(H,9,16)/t3-,4-,5-,6-,7+/m1/s1 |
|
| inchikey |
ZSJLQEPLLKMAKR-GKHCUFPYSA-N |
|
| label |
streptozocin |
|
| mass |
265.22072 |
|
| monoisotopicmass |
265.09100 |
|
| notation |
CHEBI:9288 |
|
| prefLabel |
streptozocin |
|
| smiles |
CN(N=O)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
|
| subClassOf |