loading...| Preferred Name |
piroxicam |
|
| Synonyms |
Piroxicam 4-hydroxy-2-methyl-N-pyridin-2-yl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide 4-Hydroxy-2-methyl-N-(2-pyridyl)-2H-1,2-benzothiazin-3-caboxyamid-1,1-dioxid piroxicam piroxicamum Pyroxycam FELDENE Feldene |
|
| Definitions |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid 1,1-dioxide with the exocyclic nitrogen of 2-aminopyridine. A non-steroidal anti-inflammatory drug of the oxicam class, it is used to relieve pain and works by preventing the production of endogenous prostaglandins involved in the mediation of pain, stiffness, tenderness and swelling. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8249 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:627692 PMID:28166217 KEGG:D00127 Patent:US3591584 Wikipedia:Piroxicam DrugBank:DB00554 CAS:36322-90-4 Reaxys:627692 PMID:12154043 PMID:11142413 Drug_Central:2210 HMDB:HMDB0014694 Patent:DE1943265 KEGG:C01608 |
|
| definition |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid 1,1-dioxide with the exocyclic nitrogen of 2-aminopyridine. A non-steroidal anti-inflammatory drug of the oxicam class, it is used to relieve pain and works by preventing the production of endogenous prostaglandins involved in the mediation of pain, stiffness, tenderness and swelling. |
|
| formula |
C15H13N3O4S |
|
| has exact synonym |
Piroxicam 4-hydroxy-2-methyl-N-pyridin-2-yl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35480 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-Hydroxy-2-methyl-N-(2-pyridyl)-2H-1,2-benzothiazin-3-caboxyamid-1,1-dioxid piroxicam piroxicamum Pyroxycam FELDENE Feldene |
|
| id |
CHEBI:8249 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H13N3O4S/c1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h2-9,19H,1H3,(H,16,17,20) |
|
| inchikey |
QYSPLQLAKJAUJT-UHFFFAOYSA-N |
|
| label |
piroxicam |
|
| mass |
331.34600 |
|
| monoisotopicmass |
331.06268 |
|
| notation |
CHEBI:8249 |
|
| prefLabel |
piroxicam |
|
| smiles |
CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46899 |