loading...| Preferred Name |
nandrolone |
|
| Synonyms |
Nandrolone 17beta-hydroxyestr-4-en-3-one 19-Norandrostenolone 19-Nortestosterone 17beta-hydroxy-4-estren-3-one (17beta)-17-hydroxyestr-4-en-3-one 17beta-hydroxy-19-nor-4-androsten-3-one 4-estren-17beta-ol-3-one Norandrolone Phenyl Propionate Nerobil NPP Nandrolin Nandrobolic Testosterone Phenylpropionate Nerobiolil Fenobolin FTS Norandrostenolone Nerobolil Superanabolon Nortestosterone Nandrolon Phenylpropionate Phenylpropionate Nandrolone Phenylpionate Strabolene Phenobolin Durabol Nadrolone Phenylpropionate NTPP Nandrolone Phenylpropionate Deca-Durabolin 19NTPP Durabolin Activin |
|
| Definitions |
C18 steroid with androgenic and anabolic properties. It is generally prepared from alkyl ethers of estradiol to resemble testosterone but less one carbon at the 19 position. Pharmacology: Nandrolone is an anabolic steroid occurring naturally in the human body, albeit in small quantities. Nandrolone increases production and urinary excretion of erythropoietin. It may also have a direct action on bone marrow. Nandrolone binds to the androgen receptor to a greater degree than testosterone, but due to its inability to act on the muscle in ways unmediated by the receptor, has less overall effect on muscle growth. Mechanism of action: Nandrolone is an androgen receptor agonist. Drug type: Approved. Illicit. Small Molecule. Drug category: Anabolic Agents. Androgens A 3-oxo Delta(4)-steroid that is estr-4-en-3-one substituted by a beta-hydroxy group at position 17. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7466 |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
CAS:434-22-0 KEGG:C07254 VSDB:1861 DrugBank:DB00984 Gmelin:1228044 Drug_Central:1879 PMID:24405322 PMID:19055689 PMID:20020363 Wikipedia:Nandrolone PMID:11888015 Beilstein:2055849 KEGG:D08250 Reaxys:2055849 HMDB:HMDB0002725 Beilstein:4690380 |
|
| definition |
C18 steroid with androgenic and anabolic properties. It is generally prepared from alkyl ethers of estradiol to resemble testosterone but less one carbon at the 19 position. Pharmacology: Nandrolone is an anabolic steroid occurring naturally in the human body, albeit in small quantities. Nandrolone increases production and urinary excretion of erythropoietin. It may also have a direct action on bone marrow. Nandrolone binds to the androgen receptor to a greater degree than testosterone, but due to its inability to act on the muscle in ways unmediated by the receptor, has less overall effect on muscle growth. Mechanism of action: Nandrolone is an androgen receptor agonist. Drug type: Approved. Illicit. Small Molecule. Drug category: Anabolic Agents. Androgens |
|
| formula |
C18H26O2 |
|
| has characteristic | ||
| has exact synonym |
Nandrolone 17beta-hydroxyestr-4-en-3-one |
|
| has parent hydride | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
19-Norandrostenolone 19-Nortestosterone 17beta-hydroxy-4-estren-3-one (17beta)-17-hydroxyestr-4-en-3-one 17beta-hydroxyestr-4-en-3-one 17beta-hydroxy-19-nor-4-androsten-3-one 4-estren-17beta-ol-3-one |
|
| hasExternalSource |
DB00984 |
|
| id |
CHEBI:7466 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
|
| inchikey |
NPAGDVCDWIYMMC-IZPLOLCNSA-N |
|
| label |
nandrolone |
|
| mass |
274.39780 |
|
| modifiedDate |
May 21, 2010 |
|
| monoisotopicmass |
274.19328 |
|
| notation |
CHEBI:7466 |
|
| prefLabel |
nandrolone |
|
| smiles |
[H][C@]12CCC(=O)C=C1CC[C@]1([H])[C@]2([H])CC[C@]2(C)[C@@H](O)CC[C@@]12[H] |
|
| synonym |
Norandrolone Phenyl Propionate Nerobil NPP Nandrolin Nandrobolic Testosterone Phenylpropionate Nerobiolil Fenobolin FTS Norandrostenolone Nerobolil Superanabolon Nortestosterone Nandrolon Phenylpropionate Phenylpropionate Nandrolone Phenylpionate Strabolene Phenobolin Durabol Nadrolone Phenylpropionate NTPP Nandrolone Phenylpropionate Deca-Durabolin 19NTPP Durabolin Activin |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35343 http://uri.neuinfo.org/nif/nifstd/nlx_chem_1003011 |