loading...| Preferred Name |
methotrimeprazine |
|
| Synonyms |
Methotrimeprazine (2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine levomepromazine Levomepromazine 2-Methoxytrimeprazine levomepromazina (-)-10-(3-(Dimethylamino)-2-methylpropyl)-2-methoxyphenothiazine levomepromazinum (-)-(2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
|
| Definitions |
A member of the class of phenothiazines that is 10H-phenothiazine substituted by a (2R)-3-(dimethylamino)-2-methylpropyl group and a methoxy group at positions 10 and 2 respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6838 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:11026079 LINCS:LSM-2778 Patent:US2837518 Reaxys:92434 DrugBank:DB01403 PMID:20825390 HMDB:HMDB0015474 KEGG:D00403 Drug_Central:1752 KEGG:D06474 KEGG:C07192 CAS:60-99-1 Beilstein:92434 PMID:15700129 PMID:11260766 Wikipedia:Levomepromazine |
|
| definition |
A member of the class of phenothiazines that is 10H-phenothiazine substituted by a (2R)-3-(dimethylamino)-2-methylpropyl group and a methoxy group at positions 10 and 2 respectively. |
|
| formula |
C19H24N2OS |
|
| has exact synonym |
Methotrimeprazine (2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_37930 http://purl.obolibrary.org/obo/CHEBI_48873 http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_76779 http://purl.obolibrary.org/obo/CHEBI_48561 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
levomepromazine Levomepromazine 2-Methoxytrimeprazine levomepromazina (-)-10-(3-(Dimethylamino)-2-methylpropyl)-2-methoxyphenothiazine levomepromazinum (-)-(2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
|
| id |
CHEBI:6838 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3/t14-/m1/s1 |
|
| inchikey |
VRQVVMDWGGWHTJ-CQSZACIVSA-N |
|
| label |
methotrimeprazine |
|
| mass |
328.47274 |
|
| monoisotopicmass |
328.16093 |
|
| notation |
CHEBI:6838 |
|
| prefLabel |
methotrimeprazine |
|
| smiles |
COc1ccc2Sc3ccccc3N(C[C@H](C)CN(C)C)c2c1 |
|
| subClassOf |