Preferred Name |
ibuprofen |
|
Synonyms |
2-[4-(2-methylpropyl)phenyl]propanoic acid Ibuprofen Femadon Lebrufen Inoven Anflagen (RS)-ibuprofen Nobgen Ibu-Attritin (+-)-alpha-methyl-4-(2-methylpropyl)benzeneacetic acid Apsifen Bluton Brufen Dolgit Nobfen Dolo-Dolgit Butylenin Inabrin (+-)-ibuprofen Epobron Roidenin Ibumetin Liptan Advil Adran alpha-(4-isobutylphenyl)propionic acid Nurofen Motrin Dolgirid Ibuprocin Medipren (4-isobutylphenyl)-alpha-methylacetic acid (+-)-2-(p-isobutylphenyl)propionic acid Haltran (+-)-p-isobutylhydratropic acid 4-isobutylhydratropic acid Urem Seclodin Ebufac Tabalon Brufort alpha-(p-isobutylphenyl)propionic acid Pediaprofen Ibutid Mynosedin Suspren Lamidon Trendar Nuprin Rufen Anco Amibufen Dolgin Buburone 2-(4-isobutylphenyl)propanoic acid |
|
Definitions |
A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(2-methylpropyl)phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5855 |
|
charge |
0 |
|
database_cross_reference |
PMID:12723739 KEGG:C01588 PMID:15506544 Patent:US5215755 HMDB:HMDB0001925 PMID:24168233 PMID:11433218 PMID:29756342 Patent:GB971700 CAS:15687-27-1 Reaxys:2049713 Patent:US3385886 PMID:18335846 Patent:US3228831 LINCS:LSM-1354 PMID:14562167 Drug_Central:1407 DrugBank:DB01050 Patent:US6727286 PMID:25521617 PMID:25708941 KEGG:D00126 PMID:25915907 PMID:18697608 Wikipedia:Ibuprofen PMID:16176022 Beilstein:2049713 PMID:21368281 |
|
definition |
A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(2-methylpropyl)phenyl group. |
|
formula |
C13H18O2 |
|
has exact synonym |
2-[4-(2-methylpropyl)phenyl]propanoic acid Ibuprofen |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_88188 http://purl.obolibrary.org/obo/CHEBI_78298 http://purl.obolibrary.org/obo/CHEBI_48578 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Femadon Lebrufen Inoven Anflagen (RS)-ibuprofen Nobgen Ibu-Attritin (+-)-alpha-methyl-4-(2-methylpropyl)benzeneacetic acid Apsifen Bluton Brufen Dolgit Nobfen Dolo-Dolgit Butylenin Inabrin (+-)-ibuprofen Epobron Roidenin Ibumetin Liptan Advil Adran alpha-(4-isobutylphenyl)propionic acid Nurofen Motrin Dolgirid Ibuprocin Medipren (4-isobutylphenyl)-alpha-methylacetic acid (+-)-2-(p-isobutylphenyl)propionic acid Haltran (+-)-p-isobutylhydratropic acid 4-isobutylhydratropic acid Urem Seclodin Ebufac Tabalon Brufort alpha-(p-isobutylphenyl)propionic acid Pediaprofen Ibutid Mynosedin Suspren Lamidon Trendar Nuprin Rufen Anco Amibufen Dolgin Buburone 2-(4-isobutylphenyl)propanoic acid |
|
id |
CHEBI:5855 |
|
in_subset | ||
inchi |
InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
|
inchikey |
HEFNNWSXXWATRW-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
ibuprofen |
|
mass |
206.28082 |
|
monoisotopicmass |
206.13068 |
|
notation |
CHEBI:5855 |
|
prefLabel |
ibuprofen |
|
smiles |
CC(C)Cc1ccc(cc1)C(C)C(O)=O |
|
subClassOf |