loading...| Preferred Name |
esomeprazole |
|
| Synonyms |
5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole esomeprazol Esofag Inexium paranova esomeprazolum esomeprazole Alenia (S)-(-)-omeprazole (S)-omeprazole (-)-omeprazole Escz |
|
| Definitions |
A 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole that has S configuration at the sulfur atom. An inhibitor of gastric acid secretion, it is used (generally as its sodium or magnesium salt) for the treatment of gastro-oesophageal reflux disease, dyspepsia, peptic ulcer disease, and Zollinger-Ellison syndrome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50275 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18472988 KEGG:D07917 Drug_Central:1055 CAS:119141-88-7 PMID:18407713 Wikipedia:Esomeprazole PMID:23677700 PMID:10983736 DrugBank:DB00736 Reaxys:12060639 HMDB:HMDB0005009 PMID:15080761 HMDB:HMDB0014874 |
|
| definition |
A 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole that has S configuration at the sulfur atom. An inhibitor of gastric acid secretion, it is used (generally as its sodium or magnesium salt) for the treatment of gastro-oesophageal reflux disease, dyspepsia, peptic ulcer disease, and Zollinger-Ellison syndrome. |
|
| formula |
C17H19N3O3S |
|
| has exact synonym |
5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37956 http://purl.obolibrary.org/obo/CHEBI_49200 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
esomeprazol Esofag Inexium paranova esomeprazolum esomeprazole Alenia (S)-(-)-omeprazole (S)-omeprazole (-)-omeprazole Escz |
|
| id |
CHEBI:50275 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20)/t24-/m0/s1 |
|
| inchikey |
SUBDBMMJDZJVOS-DEOSSOPVSA-N |
|
| is conjugate acid of | ||
| is enantiomer of | ||
| label |
esomeprazole |
|
| mass |
345.41600 |
|
| monoisotopicmass |
345.11471 |
|
| notation |
CHEBI:50275 |
|
| prefLabel |
esomeprazole |
|
| smiles |
COc1ccc2[nH]c(nc2c1)[S@@](=O)Cc1ncc(C)c(OC)c1C |
|
| subClassOf |