loading...| Preferred Name |
dienestrol |
|
| Synonyms |
Dienestrol 4,4'-hexa-2,4-diene-3,4-diyldiphenol Di(p-oxyphenyl)-2,4-hexadiene p,p'-(Diethylideneethylene)diphenol 4,4'-Hydroxy-gamma,delta-diphenyl-beta,delta-hexadiene Dehydrostilbestrol dienestrol |
|
| Definitions |
An olefinic compound that is hexa-2,4-diene substituted by 4-hydroxyphenyl groups at positions 3 and 4 respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4518 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:25188907 PMID:18275104 LINCS:LSM-4142 Wikipedia:Dienestrol CAS:84-17-3 KEGG:C08090 DrugBank:DB00890 KEGG:D00898 Patent:US2465505 Reaxys:2053692 Patent:US2464203 |
|
| definition |
An olefinic compound that is hexa-2,4-diene substituted by 4-hydroxyphenyl groups at positions 3 and 4 respectively. |
|
| formula |
C18H18O2 |
|
| has exact synonym |
Dienestrol 4,4'-hexa-2,4-diene-3,4-diyldiphenol |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Di(p-oxyphenyl)-2,4-hexadiene p,p'-(Diethylideneethylene)diphenol 4,4'-Hydroxy-gamma,delta-diphenyl-beta,delta-hexadiene Dehydrostilbestrol dienestrol |
|
| id |
CHEBI:4518 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H18O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3-12,19-20H,1-2H3 |
|
| inchikey |
NFDFQCUYFHCNBW-UHFFFAOYSA-N |
|
| label |
dienestrol |
|
| mass |
266.33432 |
|
| monoisotopicmass |
266.13068 |
|
| notation |
CHEBI:4518 |
|
| prefLabel |
dienestrol |
|
| smiles |
CC=C(c1ccc(O)cc1)C(=CC)c1ccc(O)cc1 |
|
| subClassOf |