Preferred Name |
benzyl benzoate |
|
Synonyms |
benzyl benzoate Benylate benzoic acid, benzyl ester benzoic acid, phenylmethyl ester phenylmethyl benzoate BENZOIC ACID PHENYLMETHYLESTER |
|
Definitions |
A benzoate ester obtained by the formal condensation of benzoic acid with benzyl alcohol. It has been isolated from the plant species of the genus Polyalthia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_41237 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:2049280 PMID:24520907 VSDB:1473 DrugBank:DB00676 PDBeChem:BZM Wikipedia:Benzyl_Benzoate PMID:19681271 PMID:24146308 HMDB:HMDB0014814 MetaCyc:CPD-6443 PMID:24761672 PPDB:1473 Drug_Central:335 Reaxys:2049280 CAS:120-51-4 PMID:18247142 Gmelin:261816 KEGG:D01138 |
|
definition |
A benzoate ester obtained by the formal condensation of benzoic acid with benzyl alcohol. It has been isolated from the plant species of the genus Polyalthia. |
|
formula |
C14H12O2 |
|
has exact synonym |
benzyl benzoate |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:41230 CHEBI:31267 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Benylate benzoic acid, benzyl ester benzoic acid, phenylmethyl ester phenylmethyl benzoate BENZOIC ACID PHENYLMETHYLESTER |
|
id |
CHEBI:41237 |
|
in_subset | ||
inchi |
InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
|
inchikey |
SESFRYSPDFLNCH-UHFFFAOYSA-N |
|
label |
benzyl benzoate |
|
mass |
212.24388 |
|
monoisotopicmass |
212.08373 |
|
notation |
CHEBI:41237 |
|
prefLabel |
benzyl benzoate |
|
smiles |
O=C(OCc1ccccc1)c1ccccc1 |
|
subClassOf |