loading...| Preferred Name |
cyclophosphamide |
|
| Synonyms |
N,N-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide (RS)-Cyclophosphamide (+-)-Cyclophosphamide Bis(2-chloroethyl)phosphoramide cyclic propanolamide ester Cyclophosphamide anhydrous N,N-bis(2-chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine 2-oxide 2-[Bis(2-chloroethylamino)]-tetrahydro-2H-1,3,2-oxazaphosphorine-2-oxide |
|
| Definitions |
A phosphorodiamide that is 1,3,2-oxazaphosphinan-2-amine 2-oxide substituted by two 2-chloroethyl groups at the amino nitrogen atom. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4027 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-4961 Reaxys:11744 PMID:7850793 KEGG:D07760 CAS:50-18-0 Wikipedia:Cyclophosphamide DrugBank:DB00531 HMDB:HMDB0014672 PMID:15711186 Beilstein:11744 Drug_Central:758 KEGG:C07888 |
|
| definition |
A phosphorodiamide that is 1,3,2-oxazaphosphinan-2-amine 2-oxide substituted by two 2-chloroethyl groups at the amino nitrogen atom. |
|
| formula |
C7H15Cl2N2O2P |
|
| has exact synonym |
N,N-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_50903 http://purl.obolibrary.org/obo/CHEBI_88188 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(RS)-Cyclophosphamide (+-)-Cyclophosphamide Bis(2-chloroethyl)phosphoramide cyclic propanolamide ester Cyclophosphamide anhydrous N,N-bis(2-chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine 2-oxide 2-[Bis(2-chloroethylamino)]-tetrahydro-2H-1,3,2-oxazaphosphorine-2-oxide |
|
| id |
CHEBI:4027 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H15Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-7H2,(H,10,12) |
|
| inchikey |
CMSMOCZEIVJLDB-UHFFFAOYSA-N |
|
| label |
cyclophosphamide |
|
| mass |
261.08544 |
|
| monoisotopicmass |
260.02482 |
|
| notation |
CHEBI:4027 |
|
| prefixIRI |
CHEBI:4027 |
|
| prefLabel |
cyclophosphamide |
|
| smiles |
ClCCN(CCCl)P1(=O)NCCCO1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36683 |