Preferred Name |
escitalopram |
|
Synonyms |
(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile (+)-citalopram Esertia escitalopram (S)-citalopram escitalopramum S(+)-citalopram S-(+)-citalopram |
|
Definitions |
A 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile that has S-configuration at the chiral centre. It is the active enantiomer of citalopram. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36791 |
|
charge |
0 |
|
database_cross_reference |
PMID:24289655 PMID:16937393 Drug_Central:1053 Beilstein:9001444 PMID:16266205 PMID:24176515 PMID:19710642 PMID:20825390 Wikipedia:Escitalopram PMID:14708881 PMID:34406668 KEGG:D07913 PMID:24528284 PMID:24424469 CAS:128196-01-0 PMID:24469525 HMDB:HMDB0005028 PMID:16421462 PMID:18789789 PMID:14501259 PMID:15200745 DrugBank:DB01175 LINCS:LSM-3569 PMID:15609164 PMID:24172161 PMID:16953656 PMID:14594439 |
|
definition |
A 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile that has S-configuration at the chiral centre. It is the active enantiomer of citalopram. |
|
formula |
C20H21FN2O |
|
has exact synonym |
(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+)-citalopram Esertia escitalopram (S)-citalopram escitalopramum S(+)-citalopram S-(+)-citalopram |
|
id |
CHEBI:36791 |
|
in_subset | ||
inchi |
InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m0/s1 |
|
inchikey |
WSEQXVZVJXJVFP-FQEVSTJZSA-N |
|
is conjugate base of | ||
is enantiomer of | ||
label |
escitalopram |
|
mass |
324.39202 |
|
monoisotopicmass |
324.16379 |
|
notation |
CHEBI:36791 |
|
prefLabel |
escitalopram |
|
smiles |
CN(C)CCC[C@]1(OCc2cc(ccc12)C#N)c1ccc(F)cc1 |
|
subClassOf |