Preferred Name |
chlorpromazine |
|
Synonyms |
3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine Chlorpromazine chlorpromazine CPZ Largactil 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine Chlorpromados N-(3-dimethylaminopropyl)-3-chlorophenothiazine Thorazine clorpromazina Chloropromazine Aminazine Chlorderazin chlorpromazinum 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine Contomin |
|
Definitions |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3647 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:621 PMID:14354584 Wikipedia:Chlorpromazine PMID:1650428 PDBeChem:Z80 PMID:7192992 Beilstein:289793 PMID:2427628 DrugBank:DB00477 HMDB:HMDB0014620 CAS:50-53-3 PMID:20825390 PMID:14404586 KEGG:D00270 PMID:15170372 Reaxys:289793 KEGG:C06906 LINCS:LSM-4017 PMID:16653219 Patent:US2645640 |
|
definition |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
formula |
C17H19ClN2S |
|
has exact synonym |
3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine Chlorpromazine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37930 http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
chlorpromazine CPZ Largactil 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine Chlorpromados N-(3-dimethylaminopropyl)-3-chlorophenothiazine Thorazine clorpromazina Chloropromazine Aminazine Chlorderazin chlorpromazinum 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine Contomin |
|
id |
CHEBI:3647 |
|
in_subset | ||
inchi |
InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
|
inchikey |
ZPEIMTDSQAKGNT-UHFFFAOYSA-N |
|
label |
chlorpromazine |
|
mass |
318.86400 |
|
monoisotopicmass |
318.09575 |
|
notation |
CHEBI:3647 |
|
prefLabel |
chlorpromazine |
|
smiles |
CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 |