Preferred Name |
octadec-9-enoic acid |
|
Synonyms |
octadec-9-enoic acid 18:1, n-9 9-octadecenoic acid Delta(9)-octadecenoic acid C18:1, n-9 |
|
Definitions |
An octadecenoic acid with a double bond at C-9. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36021 |
|
charge |
0 |
|
database_cross_reference |
CAS:2027-47-6 PMID:23578483 PMID:24478215 Reaxys:1726541 Beilstein:1726541 PMID:20110887 PMID:22908585 |
|
definition |
An octadecenoic acid with a double bond at C-9. |
|
formula |
C18H34O2 |
|
has exact synonym |
octadec-9-enoic acid |
|
has parent hydride | ||
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
18:1, n-9 9-octadecenoic acid Delta(9)-octadecenoic acid C18:1, n-9 |
|
id |
CHEBI:36021 |
|
in_subset | ||
inchi |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20) |
|
inchikey |
ZQPPMHVWECSIRJ-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
octadec-9-enoic acid |
|
mass |
282.46136 |
|
monoisotopicmass |
282.25588 |
|
notation |
CHEBI:36021 |
|
prefLabel |
octadec-9-enoic acid |
|
smiles |
[H]C(CCCCCCCC)=C([H])CCCCCCCC(O)=O |
|
subClassOf |
Create mapping