loading...| Preferred Name |
adipic acid |
|
| Synonyms |
hexanedioic acid adipic acid Adipic acid INS No. 355 1,4-butanedicarboxylic acid Adipinsaeure E355 adipinic acid 1,6-hexanedioic acid E-355 E 355 |
|
| Definitions |
An alpha,omega-dicarboxylic acid that is the 1,4-dicarboxy derivative of butane. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30832 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08839 PMID:22770225 Wikipedia:Adipic_acid Beilstein:1209788 PMID:24491734 KNApSAcK:C00001178 Reaxys:1209788 Drug_Central:3474 CAS:124-04-9 PMID:24895214 Gmelin:3166 PDBeChem:0L1 LIPID_MAPS_instance:LMFA01170048 HMDB:HMDB0000448 KEGG:C06104 MetaCyc:ADIPATE FAO/WHO_standards:174 |
|
| definition |
An alpha,omega-dicarboxylic acid that is the 1,4-dicarboxy derivative of butane. |
|
| formula |
C6H10O4 |
|
| has exact synonym |
hexanedioic acid adipic acid Adipic acid |
|
| has role | ||
| has_alternative_id |
CHEBI:2489 CHEBI:22268 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
INS No. 355 1,4-butanedicarboxylic acid Adipinsaeure E355 adipinic acid 1,6-hexanedioic acid E-355 E 355 |
|
| id |
CHEBI:30832 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
|
| inchikey |
WNLRTRBMVRJNCN-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
adipic acid |
|
| mass |
146.14120 |
|
| monoisotopicmass |
146.05791 |
|
| notation |
CHEBI:30832 |
|
| prefLabel |
adipic acid |
|
| smiles |
OC(=O)CCCCC(O)=O |
|
| subClassOf |