Preferred Name |
4-aminobenzoic acid |
|
Synonyms |
4-aminobenzoic acid 4-AMINOBENZOIC ACID 4-Aminobenzoic acid p-carboxyphenylamine ABEE gamma-aminobenzoic acid 4-Carboxyphenylamine 4-Carboxyaniline p-aminobenzoic acid 1-Amino-4-carboxybenzene para-aminobenzoic acid gamma-Aminobenzoic acid p-carboxyaniline p-Aminobenzoesaeure 4-Aminobenzoesaeure PABA 4-Amino-benzoic acid |
|
Definitions |
An aminobenzoic acid in which the amino group is para to the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30753 |
|
charge |
0 |
|
database_cross_reference |
PMID:19469519 PMID:16290145 PMID:22767283 PMID:23144588 PMID:22994574 PMID:8411009 PMID:17149871 CAS:150-13-0 KNApSAcK:C00001401 Reaxys:471605 PMID:14745019 HMDB:HMDB0001392 PMID:15115392 PDBeChem:PAB PMID:17800214 DrugBank:DB02362 PMID:1527790 Drug_Central:2049 PMID:3820215 PMID:9406595 PMID:12039592 PMID:3950915 PMID:23084339 PMID:23471007 KEGG:C00568 ECMDB:ECMDB01392 PMID:17743450 YMDB:YMDB00493 Gmelin:50150 Wikipedia:4-Aminobenzoic_acid PMID:3599019 Beilstein:471605 PMID:23063996 KEGG:D02456 |
|
definition |
An aminobenzoic acid in which the amino group is para to the carboxy group. |
|
formula |
C7H7NO2 |
|
has exact synonym |
4-aminobenzoic acid 4-AMINOBENZOIC ACID 4-Aminobenzoic acid |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
has_alternative_id |
CHEBI:20315 CHEBI:44778 CHEBI:1783 CHEBI:113372 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
p-carboxyphenylamine ABEE gamma-aminobenzoic acid 4-Carboxyphenylamine 4-Carboxyaniline p-aminobenzoic acid 1-Amino-4-carboxybenzene para-aminobenzoic acid gamma-Aminobenzoic acid p-carboxyaniline p-Aminobenzoesaeure 4-Aminobenzoesaeure PABA 4-Amino-benzoic acid |
|
id |
CHEBI:30753 |
|
in_subset | ||
inchi |
InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) |
|
inchikey |
ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
4-aminobenzoic acid |
|
mass |
137.136 |
|
monoisotopicmass |
137.04768 |
|
notation |
CHEBI:30753 |
|
prefLabel |
4-aminobenzoic acid |
|
smiles |
C1(C(O)=O)=CC=C(N)C=C1 |
|
subClassOf |