Preferred Name |
bepridil |
|
Synonyms |
N-benzyl-N-[3-(2-methylpropoxy)-2-(pyrrolidin-1-yl)propyl]aniline Bepridil Bepadin |
|
Definitions |
A tertiary amine in which the substituents on nitrogen are benzyl, phenyl and 3-(2-methylpropoxy)-2-(pyrrolidin-1-yl)propyl. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3061 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:342 LINCS:LSM-1898 KEGG:D07520 Beilstein:5993674 CAS:64706-54-3 KEGG:C06847 DrugBank:DB01244 Wikipedia:Bepridil |
|
definition |
A tertiary amine in which the substituents on nitrogen are benzyl, phenyl and 3-(2-methylpropoxy)-2-(pyrrolidin-1-yl)propyl. |
|
formula |
C24H34N2O |
|
has exact synonym |
N-benzyl-N-[3-(2-methylpropoxy)-2-(pyrrolidin-1-yl)propyl]aniline Bepridil |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_35620 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Bepadin |
|
id |
CHEBI:3061 |
|
in_subset | ||
inchi |
InChI=1S/C24H34N2O/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3 |
|
inchikey |
UIEATEWHFDRYRU-UHFFFAOYSA-N |
|
label |
bepridil |
|
mass |
366.53960 |
|
monoisotopicmass |
366.26711 |
|
notation |
CHEBI:3061 |
|
prefLabel |
bepridil |
|
smiles |
CC(C)COCC(CN(Cc1ccccc1)c1ccccc1)N1CCCC1 |
|
subClassOf |