loading...| Preferred Name |
acetohexamide |
|
| Synonyms |
4-acetyl-N-(cyclohexylcarbamoyl)benzene-1-sulfonamide acetohexamidum acetohexamida 1-((p-Acetylphenyl)sulfonyl)-3-cyclohexylurea Dymelor acetohexamide N-(p-Acetylphenylsulfonyl)-N'-cyclohexylurea 4-Acetyl-N-((cyclohexylamino)carbonyl)benzenesulfonamide |
|
| Definitions |
An N-sulfonylurea that is urea in which a hydrogen attached to one of the nitrogens is replaced by a p-acetylphenylsulfonyl group, while a hydrogen attached to the other nitrogen is replaced by a cyclohexyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28052 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:2225115 KEGG:C06806 CAS:968-81-0 PMID:8070312 Drug_Central:57 PMID:13945057 PMID:2699749 Reaxys:2225115 LINCS:LSM-5638 HMDB:HMDB0014558 KEGG:D00219 PMID:910864 Wikipedia:Acetohexamide DrugBank:DB00414 |
|
| definition |
An N-sulfonylurea that is urea in which a hydrogen attached to one of the nitrogens is replaced by a p-acetylphenylsulfonyl group, while a hydrogen attached to the other nitrogen is replaced by a cyclohexyl group. |
|
| formula |
C15H20N2O4S |
|
| has exact synonym |
4-acetyl-N-(cyclohexylcarbamoyl)benzene-1-sulfonamide |
|
| has role | ||
| has_alternative_id |
CHEBI:2395 CHEBI:22175 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
acetohexamidum acetohexamida 1-((p-Acetylphenyl)sulfonyl)-3-cyclohexylurea Dymelor acetohexamide N-(p-Acetylphenylsulfonyl)-N'-cyclohexylurea 4-Acetyl-N-((cyclohexylamino)carbonyl)benzenesulfonamide |
|
| id |
CHEBI:28052 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H20N2O4S/c1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3,(H2,16,17,19) |
|
| inchikey |
VGZSUPCWNCWDAN-UHFFFAOYSA-N |
|
| label |
acetohexamide |
|
| mass |
324.39500 |
|
| monoisotopicmass |
324.11438 |
|
| notation |
CHEBI:28052 |
|
| prefLabel |
acetohexamide |
|
| smiles |
CC(=O)c1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1 |
|
| subClassOf |