Preferred Name |
griseofulvin |
|
Synonyms |
Griseofulvin (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione griseofulvin Sporostatin Fulcin Grysio (+)-griseofulvin griseofulvinum Likuden Lamoryl Curling factor griseofulvine Fulvicin Grifulvin griseofulvina Grisactin Poncyl Spirofulvin Grisovin amudane |
|
Definitions |
An oxaspiro compound produced by Penicillium griseofulvum. It is used by mouth as an antifungal drug for infections involving the scalp, hair, nails and skin that do not respond to topical treatment. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27779 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5259 PMID:3277037 PPDB:1807 Patent:US3069329 VSDB:1807 KEGG:C06686 PMID:16922553 KEGG:D00209 Reaxys:95226 Wikipedia:Griseofulvin PMID:14407521 Patent:US3069328 PMID:25476923 DrugBank:DB00400 Drug_Central:1331 LIPID_MAPS_instance:LMPK13060001 PMID:15078340 CAS:126-07-8 MetaCyc:CPD-17786 KNApSAcK:C00002398 Beilstein:95226 PMID:23111828 |
|
definition |
An oxaspiro compound produced by Penicillium griseofulvum. It is used by mouth as an antifungal drug for infections involving the scalp, hair, nails and skin that do not respond to topical treatment. |
|
formula |
C17H17ClO6 |
|
has exact synonym |
Griseofulvin (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione griseofulvin |
|
has role | ||
has_alternative_id |
CHEBI:5546 CHEBI:24429 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Sporostatin Fulcin Grysio (+)-griseofulvin griseofulvinum Likuden Lamoryl Curling factor griseofulvine Fulvicin Grifulvin griseofulvina griseofulvin Grisactin Poncyl Spirofulvin Grisovin amudane |
|
id |
CHEBI:27779 |
|
in_subset | ||
inchi |
InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17+/m1/s1 |
|
inchikey |
DDUHZTYCFQRHIY-RBHXEPJQSA-N |
|
label |
griseofulvin |
|
mass |
352.76598 |
|
monoisotopicmass |
352.07137 |
|
notation |
CHEBI:27779 |
|
prefLabel |
griseofulvin |
|
smiles |
COc1cc(OC)c2C(=O)[C@]3(Oc2c1Cl)[C@H](C)CC(=O)C=C3OC |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38830 http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/CHEBI_87128 |