loading...| Preferred Name |
psoralen |
|
| Synonyms |
psoralen Psoralen 7H-furo[3,2-g]chromen-7-one 7H-furo[3,2-g][1]benzopyran-7-one furo[4',5':6,7]coumarin 6,7-furanocoumarin furocoumarin psoralene Manaderm Ficusin 6-hydroxy-5-benzofuranacrylic acid delta-lactone furo[2',3':7,6]coumarin 3-(6-hydroxy-5-benzofuranyl)-2-propenoic acid delta-lactone |
|
| Definitions |
The simplest member of the class of psoralens that is 7H-furo[3,2-g]chromene having a keto group at position 7. It has been found in plants like Psoralea corylifolia and Ficus salicifolia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27616 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:152784 PMID:21468912 CAS:66-97-7 KNApSAcK:C00000297 Wikipedia:Psoralen KEGG:D08450 Reaxys:152784 KEGG:C09305 PMID:20196083 |
|
| definition |
The simplest member of the class of psoralens that is 7H-furo[3,2-g]chromene having a keto group at position 7. It has been found in plants like Psoralea corylifolia and Ficus salicifolia. |
|
| formula |
C11H6O3 |
|
| has exact synonym |
psoralen Psoralen 7H-furo[3,2-g]chromen-7-one |
|
| has role | ||
| has_alternative_id |
CHEBI:26368 CHEBI:378534 CHEBI:8615 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
7H-furo[3,2-g][1]benzopyran-7-one furo[4',5':6,7]coumarin 6,7-furanocoumarin furocoumarin psoralene Manaderm Ficusin 6-hydroxy-5-benzofuranacrylic acid delta-lactone furo[2',3':7,6]coumarin 3-(6-hydroxy-5-benzofuranyl)-2-propenoic acid delta-lactone |
|
| id |
CHEBI:27616 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
|
| inchikey |
ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
|
| label |
psoralen |
|
| mass |
186.16350 186.16354 |
|
| monoisotopicmass |
186.03169 |
|
| notation |
CHEBI:27616 |
|
| prefLabel |
psoralen |
|
| smiles |
O=c1ccc2cc3ccoc3cc2o1 |
|
| subClassOf |