Preferred Name |
leucine |
|
Synonyms |
leucine Leuzin Hleu L (+-)-Leucine DL-Leucine (RS)-Leucine Leu 2-amino-4-methylpentanoic acid Leucin |
|
Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
|
charge |
0 |
|
database_cross_reference |
PMID:17439666 KEGG:C16439 Gmelin:50203 CAS:328-39-2 Wikipedia:Leucine Beilstein:636005 Reaxys:636005 LIPID_MAPS_instance:LMFA01100048 |
|
definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
formula |
C6H13NO2 |
|
has exact synonym |
leucine |
|
has part | ||
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Leuzin Hleu L (+-)-Leucine DL-Leucine (RS)-Leucine Leu 2-amino-4-methylpentanoic acid Leucin |
|
id |
CHEBI:25017 |
|
in_subset | ||
inchi |
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
|
inchikey |
ROHFNLRQFUQHCH-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
label |
leucine |
|
mass |
131.17296 |
|
monoisotopicmass |
131.09463 |
|
notation |
CHEBI:25017 |
|
prefLabel |
leucine |
|
smiles |
CC(C)CC(N)C(O)=O |
|
subClassOf |