loading...| Preferred Name |
acetophenazine |
|
| Synonyms |
1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)ethanone Acetophenazine |
|
| Definitions |
A member of the class of phenothiazines that is 10H-phenothiazine substituted by a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the nitogen atom and an acetyl group at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2401 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C06807 Wikipedia:Acetophenazine Drug_Central:59 DrugBank:DB01063 HMDB:HMDB0015196 PMID:14020672 PMID:13904111 CAS:2751-68-0 PMID:13986480 PMID:14211419 Reaxys:57631 Beilstein:57631 |
|
| definition |
A member of the class of phenothiazines that is 10H-phenothiazine substituted by a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the nitogen atom and an acetyl group at position 2. |
|
| formula |
C23H29N3O2S |
|
| has exact synonym |
1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)ethanone Acetophenazine |
|
| has functional parent | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:2401 |
|
| in_subset | ||
| inchi |
InChI=1S/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3 |
|
| inchikey |
WNTYBHLDCKXEOT-UHFFFAOYSA-N |
|
| label |
acetophenazine |
|
| mass |
411.56138 |
|
| monoisotopicmass |
411.19805 |
|
| notation |
CHEBI:2401 |
|
| prefLabel |
acetophenazine |
|
| smiles |
CC(=O)c1ccc2Sc3ccccc3N(CCCN3CCN(CCO)CC3)c2c1 |
|
| subClassOf |