Preferred Name |
creatine |
|
Synonyms |
N-[amino(imino)methyl]-N-methylglycine Creatine N-Methyl-N-guanylglycine ((amino(imino)methyl)(methyl)amino)acetic acid Kreatin N-(aminoiminomethyl)-N-methylglycine N-amidinosarcosine (N-methylcarbamimidamido)acetic acid alpha-Methylguanidino acetic acid N-methyl-N-guanylglycine (alpha-methylguanido)acetic acid Methylglycocyamine N-[(E)-AMINO(IMINO)METHYL]-N-METHYLGLYCINE N-carbamimidoyl-N-methylglycine Creatin |
|
Definitions |
A glycine derivative having methyl and amidino groups attached to the nitrogen. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16919 |
|
charge |
0 |
|
database_cross_reference |
PMID:17253521 PMID:22252611 PMID:22038587 PMID:22465051 Beilstein:907175 PMID:22429992 PMID:12184144 DrugBank:DB00148 HMDB:HMDB0000064 PMID:12085493 PDBeChem:CRN MetaCyc:CREATINE PMID:11356982 Wikipedia:Creatine PMID:19082141 PMID:19651674 Reaxys:907175 PMID:16445883 PMID:19968328 Gmelin:240513 Drug_Central:4661 PMID:11483809 KEGG:C00300 PMID:11867929 CAS:57-00-1 PMID:21698493 PMID:18555535 PMID:12878267 PMID:22196490 PMID:7752905 PMID:21556832 PMID:22422801 PMID:17190852 PMID:22521466 PMID:17416441 PMID:22101931 PMID:19741514 PMID:22347384 Chemspider:566 PMID:21660517 PMID:22386973 |
|
definition |
A glycine derivative having methyl and amidino groups attached to the nitrogen. |
|
formula |
C4H9N3O2 |
|
has exact synonym |
N-[amino(imino)methyl]-N-methylglycine Creatine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:3909 CHEBI:23404 CHEBI:41678 CHEBI:14028 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-Methyl-N-guanylglycine ((amino(imino)methyl)(methyl)amino)acetic acid Kreatin N-(aminoiminomethyl)-N-methylglycine N-amidinosarcosine (N-methylcarbamimidamido)acetic acid alpha-Methylguanidino acetic acid N-methyl-N-guanylglycine (alpha-methylguanido)acetic acid Methylglycocyamine N-[(E)-AMINO(IMINO)METHYL]-N-METHYLGLYCINE N-carbamimidoyl-N-methylglycine Creatin |
|
id |
CHEBI:16919 |
|
in_subset | ||
inchi |
InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
|
inchikey |
CVSVTCORWBXHQV-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is tautomer of | ||
label |
creatine |
|
mass |
131.13328 |
|
monoisotopicmass |
131.06948 |
|
notation |
CHEBI:16919 |
|
prefLabel |
creatine |
|
smiles |
CN(CC(O)=O)C(N)=N |
|
subClassOf |