Preferred Name |
zolmitriptan |
|
Synonyms |
(4S)-4-({3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one zolmitriptan Zominat Zomigoro zolmitriptanum 4-[[3-(2-dimethylaminoethyl)-1H-indol-5-yl]methyl]oxazolidin-2-one 311C90 Zomig Zipton |
|
Definitions |
A member of the class of tryptamines that is N,N-dimethyltryptamine in which the hydrogen at position 5 of the indole ring has been replaced by a [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl group. A serotonin 5-HT1 B and D receptor agonist, it is used for the treatment of migraine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_10124 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Zolmitriptan LINCS:LSM-3208 Beilstein:7415010 Drug_Central:2869 CAS:139264-17-8 KEGG:D00415 KEGG:C07218 DrugBank:DB00315 |
|
definition |
A member of the class of tryptamines that is N,N-dimethyltryptamine in which the hydrogen at position 5 of the indole ring has been replaced by a [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl group. A serotonin 5-HT1 B and D receptor agonist, it is used for the treatment of migraine. |
|
formula |
C16H21N3O2 |
|
has exact synonym |
(4S)-4-({3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35941 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
zolmitriptan Zominat Zomigoro zolmitriptanum 4-[[3-(2-dimethylaminoethyl)-1H-indol-5-yl]methyl]oxazolidin-2-one 311C90 Zomig Zipton |
|
id |
CHEBI:10124 |
|
in_subset | ||
inchi |
InChI=1S/C16H21N3O2/c1-19(2)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13-10-21-16(20)18-13/h3-4,8-9,13,17H,5-7,10H2,1-2H3,(H,18,20)/t13-/m0/s1 |
|
inchikey |
ULSDMUVEXKOYBU-ZDUSSCGKSA-N |
|
label |
zolmitriptan |
|
mass |
287.357 |
|
monoisotopicmass |
287.16338 |
|
notation |
CHEBI:10124 |
|
prefLabel |
zolmitriptan |
|
smiles |
C1=C2C(=CNC2=CC=C1C[C@@H]3NC(=O)OC3)CCN(C)C |
|
subClassOf |