loading...| Preferred Name |
ketotifen |
| Synonyms |
ketotifenum ketotifeno 4-(1-methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one ketotifen 10-(1-methyl-4-piperidinylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one ketotifene |
| Definitions |
An organic heterotricyclic compound that is 4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one which is substituted at position 4 by a 1-methylpiperidin-4-ylidene group. A blocker of histamine H1 receptors with a stabilising action on mast cells, it is used (usually as its hydrogen fumarate salt) for the treatment of asthma, where it may take several weeks to exert its full effect. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_92511 |
| charge |
0 |
| database_cross_reference |
LINCS:LSM-2637 Wikipedia:Ketotifen HMDB:HMDB0015056 DrugBank:DB00920 Drug_Central:1530 CAS:34580-13-7 KEGG:D08105 Patent:DE2111071 Patent:US3682930 |
| definition |
An organic heterotricyclic compound that is 4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one which is substituted at position 4 by a 1-methylpiperidin-4-ylidene group. A blocker of histamine H1 receptors with a stabilising action on mast cells, it is used (usually as its hydrogen fumarate salt) for the treatment of asthma, where it may take several weeks to exert its full effect. |
| formula |
C19H19NOS |
| has role | |
| has_exact_synonym |
4-(1-methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
ketotifenum ketotifeno ketotifen 10-(1-methyl-4-piperidinylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one ketotifene |
| id |
CHEBI:92511 |
| in_subset | |
| inchi |
InChI=1S/C19H19NOS/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19/h2-5,8,11H,6-7,9-10,12H2,1H3 |
| inchikey |
ZCVMWBYGMWKGHF-UHFFFAOYSA-N |
| is conjugate base of | |
| label |
ketotifen |
| mass |
309.427 |
| monoisotopicmass |
309.119 |
| notation |
CHEBI:92511 |
| prefixIRI |
CHEBI:92511 |
| prefLabel |
ketotifen |
| smiles |
CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26151 http://purl.obolibrary.org/obo/CHEBI_3992 http://purl.obolibrary.org/obo/CHEBI_50996 http://purl.obolibrary.org/obo/CHEBI_78840 |