Preferred Name |
methimazole |
Synonyms |
Favistan thiamazolum Methimazole tiamazol thiamazole Tapazole 1-methyl-1,3-dihydro-2H-imidazole-2-thione Thacapzol 1-METHYL-1,3-DIHYDRO-2H-IMIDAZOLE-2-THIONE 1-Methylimidazole-2(3H)-thione thiamazol Danantizol Strumazol USAF el-30 |
Definitions |
A member of the class of imidazoles that it imidazole-2-thione in which a methyl group replaces the hydrogen which is attached to a nitrogen. |
ID |
http://purl.obolibrary.org/obo/CHEBI_50673 |
charge |
0 |
database_cross_reference |
PDBeChem:MMZ Wikipedia:Methimazole Reaxys:108646 Beilstein:108646 KEGG:D00401 PMID:24443787 PMID:17438883 PMID:7454742 CAS:60-56-0 DrugBank:DB00763 HMDB:HMDB0014901 MetaCyc:CPD-11282 Drug_Central:1745 PMID:9172960 LINCS:LSM-5646 |
definition |
A member of the class of imidazoles that it imidazole-2-thione in which a methyl group replaces the hydrogen which is attached to a nitrogen. |
formula |
C4H6N2S |
has role | |
has_alternative_id |
CHEBI:44168 CHEBI:6828 |
has_exact_synonym |
Methimazole 1-methyl-1,3-dihydro-2H-imidazole-2-thione |
has_obo_namespace |
chebi_ontology |
has_related_synonym |
Favistan thiamazolum tiamazol thiamazole Tapazole Thacapzol 1-METHYL-1,3-DIHYDRO-2H-IMIDAZOLE-2-THIONE 1-Methylimidazole-2(3H)-thione thiamazol Danantizol Strumazol USAF el-30 |
id |
CHEBI:50673 |
in_subset | |
inchi |
InChI=1S/C4H6N2S/c1-6-3-2-5-4(6)7/h2-3H,1H3,(H,5,7) |
inchikey |
PMRYVIKBURPHAH-UHFFFAOYSA-N |
label |
methimazole |
mass |
114.16900 |
monoisotopicmass |
114.025 |
notation |
CHEBI:50673 |
prefixIRI |
CHEBI:50673 |
prefLabel |
methimazole |
smiles |
Cn1cc[nH]c1=S |
subClassOf |