loading...| Preferred Name |
phosphonic acid |
|
| Synonyms |
Phosphonic acid dihydrogen hydridotrioxophosphate(2-) phosphonic acid hydridodihydroxidooxidophosphorus hydridotrioxophosphoric(2-) acid ABLZXFCXXLZCGV-UHFFFAOYSA-N H2PHO3 H3O3P Phosphonsaeure HPO(OH)2 81.99580 [PHO(OH)2] H3PO3 Phosphonate OP(O)=O 81.982 InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3) 0 Phosphite (HO)2HPO |
|
| Definitions |
A phosphorus oxoacid that consists of a single pentavalent phosphorus covalently bound via single bonds to a single hydrogen and two hydroxy groups and via a double bond to an oxygen. The parent of the class of phosphonic acids. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44976 |
|
| database_cross_reference |
Wikipedia:Phosphonic_acid Gmelin:1619 CAS:13598-36-2 PDBeChem:PHS Reaxys:1209272 KEGG:C06701 |
|
| has exact synonym |
Phosphonic acid dihydrogen hydridotrioxophosphate(2-) phosphonic acid hydridodihydroxidooxidophosphorus hydridotrioxophosphoric(2-) acid |
|
| has role | ||
| has_alternative_id |
CHEBI:26067 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ABLZXFCXXLZCGV-UHFFFAOYSA-N H2PHO3 H3O3P Phosphonsaeure HPO(OH)2 81.99580 [PHO(OH)2] H3PO3 Phosphonate OP(O)=O 81.982 InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3) 0 Phosphite (HO)2HPO |
|
| id |
CHEBI:44976 |
|
| in_subset | ||
| is conjugate acid of | ||
| is tautomer of | ||
| label |
phosphonic acid |
|
| notation |
CHEBI:44976 |
|
| prefLabel |
phosphonic acid |
|
| textual definition |
A phosphorus oxoacid that consists of a single pentavalent phosphorus covalently bound via single bonds to a single hydrogen and two hydroxy groups and via a double bond to an oxygen. The parent of the class of phosphonic acids. |
|
| subClassOf |