loading...| Preferred Name |
noradrenaline |
|
| Synonyms |
4-(2-amino-1-hydroxyethyl)benzene-1,2-diol InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 169.074 NCC(O)c1ccc(O)c(O)c1 169.17788 C8H11NO3 norepinephrine 0 SFLSHLFXELFNJZ-UHFFFAOYSA-N noradrenalina |
|
| Definitions |
A catecholamine in which C-1 of the aminoethyl side-chain is hydroxy-substituted. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_33569 |
|
| database_cross_reference |
colombos:NOREPINEPHRINE LINCS:LSM-5181 Gmelin:863925 Beilstein:2210994 CAS:138-65-8 |
|
| has exact synonym |
4-(2-amino-1-hydroxyethyl)benzene-1,2-diol |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 169.074 NCC(O)c1ccc(O)c(O)c1 169.17788 C8H11NO3 norepinephrine 0 SFLSHLFXELFNJZ-UHFFFAOYSA-N noradrenalina |
|
| id |
CHEBI:33569 |
|
| in_subset | ||
| label |
noradrenaline |
|
| notation |
CHEBI:33569 |
|
| prefLabel |
noradrenaline |
|
| textual definition |
A catecholamine in which C-1 of the aminoethyl side-chain is hydroxy-substituted. |
|
| subClassOf |