loading...| Preferred Name |
adrenaline |
|
| Synonyms |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol dl-adrenaline 2-(methylamino)-1-(3,4-dihydroxyphenyl)ethanol CNCC(O)c1ccc(O)c(O)c1 InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 racepinefrinum 183.20446 (+-)-adrenaline C9H13NO3 racepinefrine epinephrine racemic 183.090 racepinefrina (+-)-epinephrine 0 UCTWMZQNUQWSLP-UHFFFAOYSA-N |
|
| Definitions |
A catecholamine in which the aminoethyl side-chain is hydroxy-substituted at C-1 and methylated on nitrogen. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_33568 |
|
| database_cross_reference |
colombos:EPINEPHRINE PMID:10052027 Drug_Central:4508 LINCS:LSM-4958 Reaxys:2212160 Gmelin:51559 Beilstein:2212160 CAS:329-65-7 PMID:24719616 PMID:24252294 |
|
| has exact synonym |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dl-adrenaline 2-(methylamino)-1-(3,4-dihydroxyphenyl)ethanol CNCC(O)c1ccc(O)c(O)c1 InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 racepinefrinum 183.20446 (+-)-adrenaline C9H13NO3 racepinefrine epinephrine racemic 183.090 racepinefrina (+-)-epinephrine 0 UCTWMZQNUQWSLP-UHFFFAOYSA-N |
|
| id |
CHEBI:33568 |
|
| in_subset | ||
| label |
adrenaline |
|
| notation |
CHEBI:33568 |
|
| prefLabel |
adrenaline |
|
| textual definition |
A catecholamine in which the aminoethyl side-chain is hydroxy-substituted at C-1 and methylated on nitrogen. |
|
| subClassOf |