Preferred Name |
arginine |
|
Synonyms |
arginine Arginine NC(CCCNC(N)=N)C(O)=O 2-amino-5-(carbamimidamido)pentanoic acid Arginin 174.20112 C6H14N4O2 InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) ODKSFYDXXFIFQN-UHFFFAOYSA-N 2-amino-5-guanidinopentanoic acid 0 Harg 174.112 2-Amino-5-guanidinovaleric acid |
|
Definitions |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29016 |
|
database_cross_reference |
colombos:ARGININE Beilstein:1725411 KEGG:C02385 Reaxys:1725411 CAS:7200-25-1 Wikipedia:L-Arginine PMID:10848923 |
|
formula |
C6H14N4O2 |
|
has exact synonym |
arginine Arginine |
|
has part | ||
has role | ||
has_alternative_id |
CHEBI:2643 CHEBI:22616 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
NC(CCCNC(N)=N)C(O)=O 2-amino-5-(carbamimidamido)pentanoic acid Arginin 174.20112 C6H14N4O2 InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) ODKSFYDXXFIFQN-UHFFFAOYSA-N 2-amino-5-guanidinopentanoic acid 0 Harg 174.112 2-Amino-5-guanidinovaleric acid |
|
id |
CHEBI:29016 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
|
inchikey |
ODKSFYDXXFIFQN-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
label |
arginine |
|
mass |
174.20112 |
|
monoisotopicmass |
174.112 |
|
notation |
CHEBI:29016 |
|
prefLabel |
arginine |
|
smiles |
NC(CCCNC(N)=N)C(O)=O |
|
textual definition |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
|
subClassOf |