loading...| Preferred Name |
cortisol |
|
| Synonyms |
Cortisol cortisol 11beta,17,21-trihydroxypregn-4-ene-3,20-dione [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione 4-pregnen-11beta,17alpha,21-triol-3,20-dione Reichstein's substance M C21H30O5 Kendall's compound F 362.45990 hydrocortisone 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisonum 362.209 hidrocortisona InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 17-hydroxycorticosterone 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione Hydrocortisone 11beta-hydrocortisone 0 |
|
| Definitions |
A C21-steroid that is pregn-4-ene substituted by oxo groups at positions 3 and 20 and hydroxy groups at positions 11, 17 and 21. Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17650 |
|
| database_cross_reference |
colombos:HYDROCORTISONE LIPID_MAPS_instance:LMST02030001 DrugBank:DB00741 PMID:10438974 CAS:50-23-7 Beilstein:1354819 PDBeChem:HCY PMID:2268561 KEGG:C00735 LINCS:LSM-5980 Patent:US2602769 Drug_Central:1388 Wikipedia:Hydrocortisone KEGG:D00088 |
|
| has exact synonym |
Cortisol cortisol 11beta,17,21-trihydroxypregn-4-ene-3,20-dione |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_35472 |
|
| has_alternative_id |
CHEBI:24633 CHEBI:58221 CHEBI:3893 CHEBI:14023 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione 4-pregnen-11beta,17alpha,21-triol-3,20-dione Reichstein's substance M C21H30O5 Kendall's compound F 362.45990 hydrocortisone 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisonum 362.209 hidrocortisona InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 17-hydroxycorticosterone 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione Hydrocortisone 11beta-hydrocortisone 0 |
|
| id |
CHEBI:17650 |
|
| in_subset | ||
| label |
cortisol |
|
| notation |
CHEBI:17650 |
|
| prefLabel |
cortisol |
|
| textual definition |
A C21-steroid that is pregn-4-ene substituted by oxo groups at positions 3 and 20 and hydroxy groups at positions 11, 17 and 21. Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_35344 http://purl.obolibrary.org/obo/CHEBI_35342 http://purl.obolibrary.org/obo/CHEBI_47909 |