Preferred Name |
alanine |
|
Synonyms |
Alanine alanine 2-aminopropanoic acid 89.09322 2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanin C3H7NO2 alanina QNAYBMKLOCPYGJ-UHFFFAOYSA-N CC(N)C(O)=O InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) A 89.048 0 |
|
Definitions |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
database_cross_reference |
colombos:ALANINE Beilstein:635807 Wikipedia:Alanine Drug_Central:4306 PMID:22264337 Gmelin:2449 PMID:17439666 Reaxys:635807 KEGG:C01401 CAS:302-72-7 |
|
has exact synonym |
Alanine alanine 2-aminopropanoic acid |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:22277 CHEBI:13748 CHEBI:2539 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
89.09322 2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanin C3H7NO2 alanina QNAYBMKLOCPYGJ-UHFFFAOYSA-N CC(N)C(O)=O InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) A 89.048 0 |
|
id |
CHEBI:16449 |
|
in_subset | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
alanine |
|
notation |
CHEBI:16449 |
|
prefLabel |
alanine |
|
textual definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
subClassOf |