loading...| Preferred Name |
procainamide |
|
| Synonyms |
Procainamide 4-amino-N-[2-(diethylamino)ethyl]benzamide procainamidum procainamida InChIKey=REQCZEXYDRLIBE-UHFFFAOYSA-N p-Amino-N-(2-diethylaminoethyl)benzamide procainamide CCN(CC)CCNC(=O)c1ccc(N)cc1 p-Aminobenzoic diethylaminoethylamide InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) Biocoryl C13H21N3O |
|
| Definitions |
4-Aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8428 |
|
| database_cross_reference |
Beilstein:2214285 Wikipedia:Procainamide CiteXplore:2494958 ChemIDplus:51-06-9 DrugBank:DB01035 KEGG COMPOUND:C07401 |
|
| definition |
4-Aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
|
| has_exact_synonym |
Procainamide 4-amino-N-[2-(diethylamino)ethyl]benzamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
procainamidum procainamida InChIKey=REQCZEXYDRLIBE-UHFFFAOYSA-N p-Amino-N-(2-diethylaminoethyl)benzamide procainamide CCN(CC)CCNC(=O)c1ccc(N)cc1 p-Aminobenzoic diethylaminoethylamide InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) Biocoryl C13H21N3O |
|
| id |
CHEBI:8428 |
|
| imported from | ||
| label |
procainamide |
|
| notation |
CHEBI:8428 |
|
| prefixIRI |
CHEBI:8428 |
|
| prefLabel |
procainamide |
|
| subClassOf |