Preferred Name |
aldosterone |
|
Synonyms |
ALDOSTERONE Aldosterone aldosterone 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C=O)C(=O)CO (11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 InChIKey=PQSUYGKTWSAVDQ-ZVIOFETBSA-N C21H28O5 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al (+)-aldosterone |
|
Definitions |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27584 |
|
database_cross_reference |
DrugBank:DB04630 ChemIDplus:3224996 Wikipedia:Aldosterone NIST Chemistry WebBook:52-39-1 LIPID MAPS:LMST02030026 PDBeChem:AS4 ChemIDplus:52-39-1 CiteXplore:10438974 KEGG COMPOUND:52-39-1 KEGG COMPOUND:C01780 |
|
definition |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
has_alternative_id |
CHEBI:40919 CHEBI:2563 CHEBI:22306 |
|
has_exact_synonym |
ALDOSTERONE Aldosterone aldosterone 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C=O)C(=O)CO (11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 InChIKey=PQSUYGKTWSAVDQ-ZVIOFETBSA-N C21H28O5 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al (+)-aldosterone |
|
id |
CHEBI:27584 |
|
imported from | ||
label |
aldosterone |
|
notation |
CHEBI:27584 |
|
prefixIRI |
CHEBI:27584 |
|
prefLabel |
aldosterone |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_47788 http://purl.obolibrary.org/obo/CHEBI_25354 http://purl.obolibrary.org/obo/CHEBI_35344 http://purl.obolibrary.org/obo/CHEBI_35789 |