Preferred Name |
lysine |
|
Synonyms |
2,6-diaminohexanoic acid lysine alpha,epsilon-diaminocaproic acid NCCCCC(N)C(O)=O C6H14N2O2 InChIKey=KDXKERNSBIXSRK-UHFFFAOYSA-N Lysin K LYS InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
database_cross_reference |
Reaxys:1616991 Beilstein:1616991 Gmelin:279284 Wikipedia:Lysine CiteXplore:17439666 CiteXplore:22264337 NIST Chemistry WebBook:70-54-2 ChemIDplus:70-54-2 KEGG COMPOUND:C16440 |
|
definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
has_exact_synonym |
2,6-diaminohexanoic acid lysine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
alpha,epsilon-diaminocaproic acid NCCCCC(N)C(O)=O C6H14N2O2 InChIKey=KDXKERNSBIXSRK-UHFFFAOYSA-N Lysin K LYS InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
id |
CHEBI:25094 |
|
imported from | ||
label |
lysine |
|
notation |
CHEBI:25094 |
|
prefLabel |
lysine |
|
subClassOf |