loading...| Preferred Name |
acyclovir |
|
| Synonyms |
2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one Nc1nc2n(COCCO)cnc2c(=O)[nH]1 Zovir InChIKey=MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovirum InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) C8H11N5O3 aciclovir |
|
| Definitions |
A 2-aminopurine that has formula C8H11N5O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2453 |
|
| database_cross_reference |
Patent:DE2539963 KEGG DRUG:D00222 Wikipedia:Acyclovir Beilstein:1219402 Patent:US4199574 DrugBank:DB00787 ChemIDplus:59277-89-3 |
|
| definition |
A 2-aminopurine that has formula C8H11N5O3. |
|
| has_exact_synonym |
2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Nc1nc2n(COCCO)cnc2c(=O)[nH]1 Zovir InChIKey=MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovirum InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) C8H11N5O3 aciclovir |
|
| id |
CHEBI:2453 |
|
| imported from | ||
| label |
acyclovir |
|
| notation |
CHEBI:2453 |
|
| prefixIRI |
CHEBI:2453 |
|
| prefLabel |
acyclovir |
|
| subClassOf |