Preferred Name |
uracil |
|
Synonyms |
Uracil URACIL pyrimidine-2,4(1H,3H)-dione Urazil 2,4-Pyrimidinedione 2,4(1H,3H)-pyrimidinedione 2,4-Dioxopyrimidine Ura O=c1cc[nH]c(=O)[nH]1 InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) U InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N C4H4N2O2 |
|
Definitions |
A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17568 |
|
database_cross_reference |
CiteXplore:3654008 KEGG DRUG:D00027 CiteXplore:22171528 CiteXplore:22685418 CiteXplore:19175333 KEGG COMPOUND:C00106 Reaxys:606623 CiteXplore:22074393 KEGG COMPOUND:66-22-8 MetaCyc:URACIL CiteXplore:22447672 CiteXplore:22237209 CiteXplore:17439666 HMDB:HMDB00300 CiteXplore:22020693 CiteXplore:18815805 CiteXplore:16834123 CiteXplore:15274295 NIST Chemistry WebBook:66-22-8 CiteXplore:22120518 Gmelin:2896 CiteXplore:12855717 PDBeChem:URA Beilstein:606623 Wikipedia:Uracil CiteXplore:22299724 CiteXplore:22567906 DrugBank:DB03419 CiteXplore:18533995 CiteXplore:11279060 ChemIDplus:66-22-8 CiteXplore:22356544 CiteXplore:22483865 |
|
definition |
A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
has_alternative_id |
CHEBI:46375 CHEBI:15288 CHEBI:27210 CHEBI:9882 |
|
has_exact_synonym |
Uracil URACIL pyrimidine-2,4(1H,3H)-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Urazil 2,4-Pyrimidinedione 2,4(1H,3H)-pyrimidinedione 2,4-Dioxopyrimidine Ura O=c1cc[nH]c(=O)[nH]1 InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) U InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N C4H4N2O2 |
|
id |
CHEBI:17568 |
|
imported from | ||
label |
uracil |
|
notation |
CHEBI:17568 |
|
prefixIRI |
CHEBI:17568 |
|
prefLabel |
uracil |
|
subClassOf |