Preferred Name |
beta-alanine |
|
Synonyms |
BETA-ALANINE beta-Alanine 3-aminopropanoic acid beta-alanine C3H7NO2 beta-aminopropionic acid InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) InChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N H-beta-Ala-OH bAla omega-aminopropionic acid 3-Aminopropionic acid NCCC(O)=O |
|
Definitions |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16958 |
|
database_cross_reference |
KEGG DRUG:D07561 CiteXplore:20994958 HMDB:HMDB00056 Reaxys:906793 DrugBank:DB03107 CiteXplore:16934791 ChemIDplus:107-95-9 CiteXplore:12107759 KEGG COMPOUND:107-95-9 CiteXplore:14363188 CiteXplore:11850512 CiteXplore:18613640 NIST Chemistry WebBook:107-95-9 CiteXplore:19239140 CiteXplore:18528519 PDBeChem:BAL CiteXplore:20386120 CiteXplore:20479615 Wikipedia:Beta-Alanine Beilstein:906793 CiteXplore:20199122 KEGG COMPOUND:C00099 CiteXplore:12887142 Gmelin:49614 CiteXplore:22735334 CiteXplore:19955842 CiteXplore:11139233 MetaCyc:B-ALANINE |
|
definition |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
has_alternative_id |
CHEBI:12389 CHEBI:41050 CHEBI:22821 CHEBI:10343 |
|
has_exact_synonym |
BETA-ALANINE beta-Alanine 3-aminopropanoic acid beta-alanine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
C3H7NO2 beta-aminopropionic acid InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) InChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N H-beta-Ala-OH bAla omega-aminopropionic acid 3-Aminopropionic acid 3-aminopropanoic acid NCCC(O)=O |
|
id |
CHEBI:16958 |
|
imported from | ||
label |
beta-alanine |
|
notation |
CHEBI:16958 |
|
prefixIRI |
CHEBI:16958 |
|
prefLabel |
beta-alanine |
|
subClassOf |