Preferred Name |
methionine |
|
Synonyms |
methionine Methionine Methionin 2-amino-4-(methylsulfanyl)butanoic acid 2-Amino-4-(methylthio)butyric acid Hmet 2-amino-4-(methylthio)butanoic acid Met InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) Racemethionine DL-Methionine alpha-amino-gamma-methylmercaptobutyric acid metionina C5H11NO2S InChIKey=FFEARJCKVFRZRR-UHFFFAOYSA-N CSCCC(N)C(O)=O M |
|
Definitions |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
|
database_cross_reference |
Wikipedia:Methionine UM-BBD:c0094 CiteXplore:16702333 KEGG DRUG:D04983 Beilstein:636185 Reaxys:636185 CiteXplore:22264337 ChemIDplus:59-51-8 KEGG COMPOUND:C01733 NIST Chemistry WebBook:59-51-8 Gmelin:3117 |
|
definition |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
has_alternative_id |
CHEBI:14590 CHEBI:25229 CHEBI:6829 |
|
has_exact_synonym |
methionine Methionine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Methionin 2-amino-4-(methylsulfanyl)butanoic acid 2-Amino-4-(methylthio)butyric acid Hmet 2-amino-4-(methylthio)butanoic acid Met InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) Racemethionine DL-Methionine alpha-amino-gamma-methylmercaptobutyric acid metionina C5H11NO2S InChIKey=FFEARJCKVFRZRR-UHFFFAOYSA-N CSCCC(N)C(O)=O M |
|
id |
CHEBI:16811 |
|
imported from | ||
label |
methionine |
|
notation |
CHEBI:16811 |
|
prefLabel |
methionine |
|
subClassOf |