Preferred Name |
succinic acid |
|
Synonyms |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid Dihydrofumaric acid acide succinique Butandisaeure InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) asuccin acidum succinicum Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid OC(=O)CCC(O)=O InChIKey=KDYFGRWQOYBRFD-UHFFFAOYSA-N amber acid acide butanedioique 1,2-ethanedicarboxylic acid E363 C4H6O4 spirit of amber Bernsteinsaeure |
|
Definitions |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15741 |
|
database_cross_reference |
KEGG COMPOUND:110-15-6 MetaCyc:SUC Reaxys:1754069 HMDB:HMDB00254 CiteXplore:17439666 ChemIDplus:110-15-6 NIST Chemistry WebBook:110-15-6 Wikipedia:Succinic_acid LIPID MAPS:LMFA01170043 DrugBank:DB00139 PDBeChem:SIN Beilstein:1754069 Gmelin:2785 KEGG COMPOUND:C00042 |
|
definition |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. |
|
has_alternative_id |
CHEBI:9304 CHEBI:22943 CHEBI:45639 CHEBI:26807 |
|
has_exact_synonym |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dihydrofumaric acid acide succinique Butandisaeure InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) asuccin acidum succinicum Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid OC(=O)CCC(O)=O InChIKey=KDYFGRWQOYBRFD-UHFFFAOYSA-N amber acid acide butanedioique 1,2-ethanedicarboxylic acid E363 C4H6O4 spirit of amber Bernsteinsaeure |
|
id |
CHEBI:15741 |
|
imported from | ||
label |
succinic acid |
|
notation |
CHEBI:15741 |
|
prefixIRI |
CHEBI:15741 |
|
prefLabel |
succinic acid |
|
subClassOf |