loading...| Preferred Name |
L-glutamine |
|
| Synonyms |
L-glutamine L-Glutamine Glutamic acid amide L-Glutaminsaeure-5-amid L-(+)-glutamine (2S)-2-amino-4-carbamoylbutanoic acid L-2-Aminoglutaramic acid Levoglutamide L-glutamic acid gamma-amide L-2-aminoglutaramic acid Glutamic acid 5-amide (S)-2,5-diamino-5-oxopentanoic acid (2S)-2,5-diamino-5-oxopentanoic acid GLUTAMINE L-Glutamin Q |
|
| Definitions |
An optically active form of glutamine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18050 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1723797 HMDB:HMDB0000641 PMID:22206385 KEGG:C00064 MetaCyc:GLN CAS:56-85-9 PMID:22575040 ECMDB:ECMDB00641 PDBeChem:GLN Drug_Central:1311 Wikipedia:Glutamine PMID:22451274 PMID:22453904 Reaxys:1723797 PMID:11139387 PMID:22055478 Gmelin:3509 KEGG:D00015 PMID:22770225 PMID:15204730 KNApSAcK:C00001359 YMDB:YMDB00002 DrugBank:DB00130 LINCS:LSM-4741 PMID:29438107 |
|
| definition |
An optically active form of glutamine having L-configuration. |
|
| formula |
C5H10N2O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_61908 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:42814 CHEBI:42812 CHEBI:42943 CHEBI:21308 CHEBI:13110 CHEBI:42899 CHEBI:6227 |
|
| has_exact_synonym |
L-glutamine L-Glutamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Glutamic acid amide L-Glutaminsaeure-5-amid L-(+)-glutamine (2S)-2-amino-4-carbamoylbutanoic acid L-2-Aminoglutaramic acid Levoglutamide L-glutamic acid gamma-amide L-2-aminoglutaramic acid Glutamic acid 5-amide (S)-2,5-diamino-5-oxopentanoic acid (2S)-2,5-diamino-5-oxopentanoic acid GLUTAMINE L-Glutamin Q |
|
| id |
CHEBI:18050 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 |
|
| inchikey |
ZDXPYRJPNDTMRX-VKHMYHEASA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-glutamine |
|
| mass |
146.14458 |
|
| monoisotopicmass |
146.06914 |
|
| notation |
CHEBI:18050 |
|
| prefLabel |
L-glutamine |
|
| smiles |
N[C@@H](CCC(N)=O)C(O)=O |
|
| subClassOf |