Preferred Name |
methionine |
|
Synonyms |
Methionine methionine Racemethionine DL-Methionine 2-amino-4-(methylthio)butanoic acid 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid 2-amino-4-(methylsulfanyl)butanoic acid Hmet M Met Methionin metionina |
|
Definitions |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
|
charge |
0 |
|
database_cross_reference |
CAS:59-51-8 KEGG:C01733 PMID:16702333 PMID:22264337 PMID:2543976 Wikipedia:Methionine UM-BBD_compID:c0094 Beilstein:636185 Reaxys:636185 KEGG:D04983 Gmelin:3117 |
|
definition |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
formula |
C5H11NO2S |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
has_alternative_id |
CHEBI:25229 CHEBI:14590 CHEBI:6829 |
|
has_exact_synonym |
Methionine methionine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Racemethionine DL-Methionine 2-amino-4-(methylthio)butanoic acid 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid 2-amino-4-(methylsulfanyl)butanoic acid Hmet M Met Methionin metionina |
|
id |
CHEBI:16811 |
|
in_subset | ||
inchi |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
|
inchikey |
FFEARJCKVFRZRR-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
methionine |
|
mass |
149.21238 |
|
monoisotopicmass |
149.05105 |
|
notation |
CHEBI:16811 |
|
prefLabel |
methionine |
|
smiles |
CSCCC(N)C(O)=O |
|
subClassOf |