Preferred Name |
lanosterol |
|
Synonyms |
lanosta-8,24-dien-3beta-ol LANOSTEROL Lanosterol lanosterol (3beta)-lanosta-8,24-dien-3-ol 4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol (3beta,5alpha)-4,4,14-trimethylcholesta-8,24-dien-3-ol Lanosterin |
|
Definitions |
A tetracyclic triterpenoid that is lanosta-8,24-diene substituted by a beta-hydroxy group at the 3beta position. It is the compound from which all steroids are derived. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16521 |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00003657 PMID:16445886 DrugBank:DB03696 Reaxys:2226449 PMID:21838962 PMID:21818119 Wikipedia:Lanosterol Beilstein:2226449 PMID:22824432 PMID:22988818 PMID:26200341 LIPID_MAPS_instance:LMST01010017 HMDB:HMDB0001251 PMID:26069216 PMID:22933236 PDBeChem:LAN MetaCyc:LANOSTEROL PMID:14660793 CAS:79-63-0 PMID:24525128 KEGG:C01724 |
|
definition |
A tetracyclic triterpenoid that is lanosta-8,24-diene substituted by a beta-hydroxy group at the 3beta position. It is the compound from which all steroids are derived. |
|
formula |
C30H50O |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:43584 CHEBI:14500 CHEBI:25011 CHEBI:6374 |
|
has_exact_synonym |
lanosta-8,24-dien-3beta-ol LANOSTEROL Lanosterol lanosterol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(3beta)-lanosta-8,24-dien-3-ol 4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol (3beta,5alpha)-4,4,14-trimethylcholesta-8,24-dien-3-ol Lanosterin |
|
id |
CHEBI:16521 |
|
in_subset | ||
inchi |
InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
|
inchikey |
CAHGCLMLTWQZNJ-BQNIITSRSA-N |
|
label |
lanosterol |
|
mass |
426.729 |
|
monoisotopicmass |
426.38617 |
|
notation |
CHEBI:16521 |
|
prefLabel |
lanosterol |
|
smiles |
[H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3)[C@H](C)CCC=C(C)C |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_138029 |