Preferred Name |
5-hydroxylysine |
|
Synonyms |
5-hydroxylysine 5-hydroxy-2,6-diaminohexanoic acid hydroxylysine 2,6-diamino-5-hydroxyhexanoic acid Hyl |
|
Definitions |
A hydroxylysine that is lysine substituted by a hydroxy group at position 5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_60175 |
|
charge |
0 |
|
database_cross_reference |
MetaCyc:CPD-7689 |
|
definition |
A hydroxylysine that is lysine substituted by a hydroxy group at position 5. |
|
formula |
C6H14N2O3 |
|
has_alternative_id |
CHEBI:339899 |
|
has_exact_synonym |
5-hydroxylysine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-hydroxy-2,6-diaminohexanoic acid hydroxylysine 2,6-diamino-5-hydroxyhexanoic acid Hyl |
|
id |
CHEBI:60175 |
|
in_subset | ||
inchi |
InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11) |
|
inchikey |
YSMODUONRAFBET-UHFFFAOYSA-N |
|
label |
5-hydroxylysine |
|
mass |
162.18700 |
|
monoisotopicmass |
162.10044 |
|
notation |
CHEBI:60175 |
|
prefLabel |
5-hydroxylysine |
|
smiles |
NCC(O)CCC(N)C(O)=O |
|
subClassOf |
Create mapping