Preferred Name |
ethionamide |
|
Synonyms |
2-ethylpyridine-4-carbothioamide ethionamide Ethionamide Etionamid Ethioniamide Ethyonomide 2-ethyl-4-thiopyridylamide ethionamidum ETP ETH etionamida Etioniamid Ethinamide Etionamide Ethylisothiamide Trecator |
|
Definitions |
A thiocarboxamide that is pyridine-4-carbothioamide substituted by an ethyl group at position 2. A prodrug that undergoes metabolic activation by conversion to the corresponding S-oxide. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4885 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5620 Beilstein:116474 Patent:GB800250 HMDB:HMDB0014747 Wikipedia:Ethionamide PMID:15850780 Drug_Central:1083 DrugBank:DB00609 PMID:15673755 PMID:14651620 Reaxys:116474 CAS:536-33-4 KEGG:D00591 KEGG:C07665 |
|
definition |
A thiocarboxamide that is pyridine-4-carbothioamide substituted by an ethyl group at position 2. A prodrug that undergoes metabolic activation by conversion to the corresponding S-oxide. |
|
formula |
C8H10N2S |
|
has_exact_synonym |
2-ethylpyridine-4-carbothioamide ethionamide Ethionamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Etionamid Ethioniamide Ethyonomide 2-ethyl-4-thiopyridylamide ethionamidum ETP ETH etionamida Etioniamid Ethinamide Etionamide Ethylisothiamide Trecator |
|
id |
CHEBI:4885 |
|
in_subset | ||
inchi |
InChI=1S/C8H10N2S/c1-2-7-5-6(8(9)11)3-4-10-7/h3-5H,2H2,1H3,(H2,9,11) |
|
inchikey |
AEOCXXJPGCBFJA-UHFFFAOYSA-N |
|
label |
ethionamide |
|
mass |
166.24448 |
|
monoisotopicmass |
166.05647 |
|
notation |
CHEBI:4885 |
|
prefLabel |
ethionamide |
|
smiles |
CCc1cc(ccn1)C(N)=S |
|
subClassOf |