Preferred Name |
cytarabine |
|
Synonyms |
Cytarabine 4-amino-1-beta-D-arabinofuranosylpyrimidin-2(1H)-one cytarabinum Cytosine arabinoside 4-Amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone cytosine-beta-D-arabinofuranoside ara-C 1-beta-D-Arabinofuranosylcytosine citarabina arabinocytosine Cytosine-1-beta-D-arabinofuranoside cytarabine Arabinoside C |
|
Definitions |
A pyrimidine nucleoside in which cytosine is attached to D-arabinofuranose via a beta-N(1)-glycosidic bond. Used mainly in the treatment of leukaemia, especially acute non-lymphoblastic leukaemia, cytarabine is an antimetabolite antineoplastic agent that inhibits the synthesis of DNA. It also has antiviral and immunosuppressant properties. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28680 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:89265009 SNOMEDCT:387511003 MeSH:D003561 NCIt:C408 Beilstein:89175 Reaxys:89175 Drug_Central:770 HMDB:HMDB0015122 PDBeChem:AR3 DrugBank:DB00987 LINCS:LSM-5470 KEGG:C02961 KEGG:D00168 Wikipedia:Cytarabine PMID:15492802 CAS:147-94-4 |
|
definition |
A pyrimidine nucleoside in which cytosine is attached to D-arabinofuranose via a beta-N(1)-glycosidic bond. Used mainly in the treatment of leukaemia, especially acute non-lymphoblastic leukaemia, cytarabine is an antimetabolite antineoplastic agent that inhibits the synthesis of DNA. It also has antiviral and immunosuppressant properties. |
|
formula |
C9H13N3O5 |
|
has_alternative_id |
CHEBI:23532 CHEBI:40824 CHEBI:4074 |
|
has_exact_synonym |
Cytarabine 4-amino-1-beta-D-arabinofuranosylpyrimidin-2(1H)-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
cytarabinum Cytosine arabinoside 4-Amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone cytosine-beta-D-arabinofuranoside ara-C 1-beta-D-Arabinofuranosylcytosine citarabina arabinocytosine Cytosine-1-beta-D-arabinofuranoside cytarabine Arabinoside C |
|
has_role | ||
id |
CHEBI:28680 |
|
in_subset | ||
inchi |
InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
|
inchikey |
UHDGCWIWMRVCDJ-CCXZUQQUSA-N |
|
label |
cytarabine |
|
mass |
243.21674 |
|
monoisotopicmass |
243.08552 |
|
notation |
CHEBI:28680 |
|
prefLabel |
cytarabine |
|
smiles |
Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
|
subClassOf |