Preferred Name |
acrylamide |
|
Synonyms |
Acrylamide prop-2-enamide acrylamide 2-Propenamide ethylenecarboxamide Akrylamid |
|
Definitions |
A member of the class of acrylamides that results from the formal condensation of acrylic acid with ammonia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28619 |
|
charge |
0 |
|
database_cross_reference |
MeSH:D020106 NCIt:C44329 SNOMEDCT:6983000 CAS:79-06-1 PMID:12166997 UM-BBD_compID:c0149 PMID:15240786 PMID:19022940 Patent:US2535245 PMID:15901921 Reaxys:605349 PMID:18469268 PMID:19846048 PMID:10719038 PMID:17558658 Gmelin:81842 PMID:17484107 PMID:17720246 Beilstein:605349 PMID:22784192 PMID:7767980 KEGG:C01659 HMDB:HMDB0004296 PMID:22136129 PMID:17032038 Wikipedia:Acrylamide PMID:17234719 |
|
definition |
A member of the class of acrylamides that results from the formal condensation of acrylic acid with ammonia. |
|
formula |
C3H5NO |
|
has_alternative_id |
CHEBI:22215 CHEBI:2441 |
|
has_exact_synonym |
Acrylamide prop-2-enamide acrylamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Propenamide ethylenecarboxamide Akrylamid |
|
id |
CHEBI:28619 |
|
in_subset | ||
inchi |
InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
|
inchikey |
HRPVXLWXLXDGHG-UHFFFAOYSA-N |
|
label |
acrylamide |
|
mass |
71.07794 |
|
monoisotopicmass |
71.03711 |
|
notation |
CHEBI:28619 |
|
prefLabel |
acrylamide |
|
smiles |
NC(=O)C=C |
|
subClassOf |