Preferred Name |
vincristine |
|
Synonyms |
Vincristine 22-oxovincaleukoblastine 22-Oxovincaleukoblastine leurocristine oncovin vincristin leucristine vinkristin (+)-Vincristine 22-oxo-vincaleukoblastine |
|
Definitions |
A vinca alkaloid with formula C46H56N4O10 found in the Madagascar periwinkle, Catharanthus roseus. It is used (commonly as the corresponding sulfate salt)as a chemotherapy drug for the treatment of leukaemia, lymphoma, myeloma, breast cancer and head and neck cancer. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28445 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:23079006 MeSH:D014750 SNOMEDCT:387126006 NCIt:C933 PMID:31161774 MetaCyc:CPD-19894 PMID:30604513 PMID:30277559 PMID:30657998 Drug_Central:2825 HMDB:HMDB0014681 Beilstein:4779289 KNApSAcK:C00001783 PMID:31048222 DrugBank:DB00541 PMID:31296986 KEGG:C07204 CAS:57-22-7 PMID:18520608 KEGG:D08679 PMID:30429697 PMID:31214762 Wikipedia:Vincristine PMID:30599272 |
|
definition |
A vinca alkaloid with formula C46H56N4O10 found in the Madagascar periwinkle, Catharanthus roseus. It is used (commonly as the corresponding sulfate salt)as a chemotherapy drug for the treatment of leukaemia, lymphoma, myeloma, breast cancer and head and neck cancer. |
|
formula |
C46H56N4O10 |
|
has_alternative_id |
CHEBI:9987 CHEBI:27289 |
|
has_exact_synonym |
Vincristine 22-oxovincaleukoblastine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
22-Oxovincaleukoblastine leurocristine oncovin vincristin leucristine vinkristin (+)-Vincristine 22-oxo-vincaleukoblastine |
|
has_role | ||
id |
CHEBI:28445 |
|
in_subset | ||
inchi |
InChI=1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3/t28-,37+,38-,39-,42+,43-,44-,45+,46+/m1/s1 |
|
inchikey |
OGWKCGZFUXNPDA-XQKSVPLYSA-N |
|
label |
vincristine |
|
mass |
824.95780 |
|
monoisotopicmass |
824.39964 |
|
notation |
CHEBI:28445 |
|
prefLabel |
vincristine |
|
smiles |
[H][C@@]12N3CC[C@@]11c4cc(c(OC)cc4N(C=O)[C@@]1([H])[C@](O)([C@H](OC(C)=O)[C@]2(CC)C=CC3)C(=O)OC)[C@]1(C[C@@H]2C[N@](CCc3c1[nH]c1ccccc31)C[C@](O)(CC)C2)C(=O)OC |
|
subClassOf |