Preferred Name |
xylitol |
|
Synonyms |
Xylitol meso-xylitol (2R,3r,4S)-pentane-1,2,3,4,5-pentol xylitol D-XYLITOL L-xylitol xylite Xylit (2R,3R,4S)-Pentane-1,2,3,4,5-pentaol |
|
Definitions |
A pentitol (five-carbon sugar alcohol) having meso-configuration, being derived from xylose by reduction of the carbonyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17151 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00061 Gmelin:82893 Drug_Central:4604 PMID:12061879 PMID:17336832 Beilstein:1720523 PMID:23287496 PMID:15377394 PMID:23589387 PMID:11163479 PMID:22791282 PMID:17216458 KEGG:C00379 PMID:25108762 PMID:24012734 DrugBank:DB01904 PMID:11154411 PMID:16708791 PMID:23247825 PMID:24643482 Reaxys:1720523 PMID:23796483 PMID:18316079 PMID:20030329 PMID:23615861 MetaCyc:XYLITOL CAS:87-99-0 PMID:16901854 PMID:23916161 PMID:22735334 PMID:23338824 Wikipedia:Xylitol PMID:17216457 PDBeChem:XYL PMID:17979222 HMDB:HMDB0002917 PMID:23957303 PMID:23597921 |
|
definition |
A pentitol (five-carbon sugar alcohol) having meso-configuration, being derived from xylose by reduction of the carbonyl group. |
|
formula |
C5H12O5 |
|
has_alternative_id |
CHEBI:15328 CHEBI:27339 CHEBI:60939 CHEBI:46522 CHEBI:253147 CHEBI:10078 |
|
has_exact_synonym |
Xylitol meso-xylitol (2R,3r,4S)-pentane-1,2,3,4,5-pentol xylitol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
D-XYLITOL L-xylitol xylite Xylit (2R,3R,4S)-Pentane-1,2,3,4,5-pentaol |
|
id |
CHEBI:17151 |
|
in_subset | ||
inchi |
InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
|
inchikey |
HEBKCHPVOIAQTA-SCDXWVJYSA-N |
|
label |
xylitol |
|
mass |
152.14580 |
|
monoisotopicmass |
152.06847 |
|
notation |
CHEBI:17151 |
|
prefLabel |
xylitol |
|
smiles |
OC[C@H](O)[C@@H](O)[C@H](O)CO |
|
subClassOf |