Preferred Name |
glutathione |
|
Synonyms |
L-gamma-glutamyl-L-cysteinylglycine Glutathione 5-L-Glutamyl-L-cysteinylglycine Reduced glutathione N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine gamma-L-Glutamyl-L-cysteinyl-glycine GSH Glutathione-SH |
|
Definitions |
A tripeptide compound consisting of glutamic acid attached via its side chain to the N-terminus of cysteinylglycine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16856 |
|
charge |
0 |
|
database_cross_reference |
PMID:16391576 KEGG:D00014 Reaxys:1729812 Wikipedia:Glutathione PMID:14988435 PMID:10577998 PMID:16621738 PMID:19580823 Chemspider:111188 PMID:17439666 PMID:16112416 PMID:16780237 Drug_Central:1312 PMID:16404476 PMID:16877380 PMID:1362956 HMDB:HMDB0000125 KNApSAcK:C00001518 PMID:16316931 DrugBank:DB00143 KEGG:C00051 PMID:8207209 FooDB:FDB001498 PMID:4200890 CAS:70-18-8 PDBeChem:GSH PMID:4745654 PMID:16650398 MetaCyc:GLUTATHIONE |
|
definition |
A tripeptide compound consisting of glutamic acid attached via its side chain to the N-terminus of cysteinylglycine. |
|
formula |
C10H17N3O6S |
|
has_alternative_id |
CHEBI:14327 CHEBI:43049 CHEBI:12402 CHEBI:5437 CHEBI:24334 CHEBI:42873 |
|
has_exact_synonym |
L-gamma-glutamyl-L-cysteinylglycine Glutathione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-L-Glutamyl-L-cysteinylglycine Reduced glutathione N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine gamma-L-Glutamyl-L-cysteinyl-glycine GSH Glutathione-SH |
|
id |
CHEBI:16856 |
|
in_subset | ||
inchi |
InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
|
inchikey |
RWSXRVCMGQZWBV-WDSKDSINSA-N |
|
label |
glutathione |
|
mass |
307.320 |
|
monoisotopicmass |
307.08381 |
|
notation |
CHEBI:16856 |
|
prefLabel |
glutathione |
|
smiles |
N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
|
subClassOf |