Preferred Name |
quercetin |
|
Synonyms |
Quercetin 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one xanthaurine sophoretin 3,3',4',5,7-pentahydroxyflavone 3,5,7,3',4'-PENTAHYDROXYFLAVONE 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one 3,5,7,3',4'-Pentahydroxyflavone |
|
Definitions |
A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. It is one of the most abundant flavonoids in edible vegetables, fruit and wine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16243 |
|
charge |
0 |
|
database_cross_reference |
PMID:19461927 FooDB:FDB011904 PMID:18549926 PDBeChem:QUE PMID:18579649 HMDB:HMDB0005794 KEGG:C00389 PMID:27591927 PMID:18096136 PMID:23359794 PMID:16226777 PMID:27704720 Gmelin:579210 PMID:27565033 PMID:27589790 PMID:23342112 PMID:17135030 Reaxys:317313 Beilstein:317313 LINCS:LSM-4199 Wikipedia:Quercetin Patent:US2013012577 PMID:17426744 LIPID_MAPS_instance:LMPK12110004 Drug_Central:3514 PMID:22920589 DrugBank:DB04216 Patent:KR20120121684 PMID:18564899 MetaCyc:CPD-520 PMID:18785622 CAS:117-39-5 PMID:17015250 KNApSAcK:C00004631 PMID:19043800 PMID:18484521 |
|
definition |
A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. It is one of the most abundant flavonoids in edible vegetables, fruit and wine. |
|
formula |
C15H10O7 |
|
has_alternative_id |
CHEBI:26472 CHEBI:14991 CHEBI:45280 CHEBI:11704 CHEBI:8696 |
|
has_exact_synonym |
Quercetin 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
xanthaurine sophoretin 3,3',4',5,7-pentahydroxyflavone 3,5,7,3',4'-PENTAHYDROXYFLAVONE 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one 3,5,7,3',4'-Pentahydroxyflavone |
|
id |
CHEBI:16243 |
|
in_subset | ||
inchi |
InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
|
inchikey |
REFJWTPEDVJJIY-UHFFFAOYSA-N |
|
label |
quercetin |
|
mass |
302.238 |
|
monoisotopicmass |
302.04265 |
|
notation |
CHEBI:16243 |
|
prefLabel |
quercetin |
|
smiles |
OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C=C2)=C1 |
|
subClassOf |